C28H23NO6S2 — CID 66571981
(2S)-2-[(5Z)-5-[[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid (PubChem CID 66571981) has the molecular formula C28H23NO6S2 and a molecular weight of 533.63 g/mol. Its IUPAC name is (2S)-2-[(5Z)-5-[[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(5Z)-5-[[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 66571981 |
| Molecular Formula | C28H23NO6S2 |
| Molecular Weight | 533.63 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | (2S)-2-[(5Z)-5-[[4-[2-(3-methoxyphenyl)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
| SMILES | COc1cccc(C(=O)COc2ccc(/C=C3\SC(=S)N([C@@H](Cc4ccccc4)C(=O)O)C3=O)cc2)c1 |
| InChI | InChI=1S/C28H23NO6S2/c1-34-22-9-5-8-20(16-22)24(30)17-35-21-12-10-19(11-13-21)15-25-26(31)29(28(36)37-25)23(27(32)33)14-18-6-3-2-4-7-18/h2-13,15-16,23H,14,17H2,1H3,(H,32,33)/b25-15-/t23-/m0/s1 |
| InChIKey | DJFYTKRYRSZDMM-GEGYVFIFSA-N |
| XLogP | 4.85 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|