C27H23NO6S2 — CID 57329525
3-(4-hydroxyphenyl)-2-[(5Z)-5-[(2-methoxy-4-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 57329525) has the molecular formula C27H23NO6S2 and a molecular weight of 521.62 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-[(5Z)-5-[(2-methoxy-4-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-(4-hydroxyphenyl)-2-[(5Z)-5-[(2-methoxy-4-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 57329525 |
| Molecular Formula | C27H23NO6S2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.10 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-[(5Z)-5-[(2-methoxy-4-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | COc1cc(OCc2ccccc2)ccc1/C=C1\SC(=S)N(C(Cc2ccc(O)cc2)C(=O)O)C1=O |
| InChI | InChI=1S/C27H23NO6S2/c1-33-23-15-21(34-16-18-5-3-2-4-6-18)12-9-19(23)14-24-25(30)28(27(35)36-24)22(26(31)32)13-17-7-10-20(29)11-8-17/h2-12,14-15,22,29H,13,16H2,1H3,(H,31,32)/b24-14- |
| InChIKey | TUDRARKWOHMHEM-OYKKKHCWSA-N |
| XLogP | 4.88 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|