C34H28ClNO5S2 — CID 18677291
2-[(5Z)-5-[[2,4-bis[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(4-chlorophenyl)acetic acid (PubChem CID 18677291) has the molecular formula C34H28ClNO5S2 and a molecular weight of 630.19 g/mol. Its IUPAC name is 2-[(5Z)-5-[[2,4-bis[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(4-chlorophenyl)acetic acid.
| Compound Name | 2-[(5Z)-5-[[2,4-bis[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(4-chlorophenyl)acetic acid |
|---|---|
| PubChem CID | 18677291 |
| Molecular Formula | C34H28ClNO5S2 |
| Molecular Weight | 630.19 g/mol |
| Exact Mass | 629.11 |
| IUPAC Name | 2-[(5Z)-5-[[2,4-bis[(4-methylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-(4-chlorophenyl)acetic acid |
| SMILES | Cc1ccc(COc2ccc(/C=C3\SC(=S)N(C(C(=O)O)c4ccc(Cl)cc4)C3=O)c(OCc3ccc(C)cc3)c2)cc1 |
| InChI | InChI=1S/C34H28ClNO5S2/c1-21-3-7-23(8-4-21)19-40-28-16-13-26(29(18-28)41-20-24-9-5-22(2)6-10-24)17-30-32(37)36(34(42)43-30)31(33(38)39)25-11-14-27(35)15-12-25/h3-18,31H,19-20H2,1-2H3,(H,38,39)/b30-17- |
| InChIKey | ITXNHXPUNDAXFE-LQNQUEJISA-N |
| XLogP | 8.14 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.19 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|