C25H18BrNO4S2 — CID 19197741
2-[(5Z)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid (PubChem CID 19197741) has the molecular formula C25H18BrNO4S2 and a molecular weight of 540.46 g/mol. Its IUPAC name is 2-[(5Z)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid.
| Compound Name | 2-[(5Z)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 19197741 |
| Molecular Formula | C25H18BrNO4S2 |
| Molecular Weight | 540.46 g/mol |
| Exact Mass | 538.99 |
| IUPAC Name | 2-[(5Z)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid |
| SMILES | O=C(O)C(c1ccccc1)N1C(=O)/C(=C/c2cc(Br)ccc2OCc2ccccc2)SC1=S |
| InChI | InChI=1S/C25H18BrNO4S2/c26-19-11-12-20(31-15-16-7-3-1-4-8-16)18(13-19)14-21-23(28)27(25(32)33-21)22(24(29)30)17-9-5-2-6-10-17/h1-14,22H,15H2,(H,29,30)/b21-14- |
| InChIKey | YCHRQJVPYFEOIJ-STZFKDTASA-N |
| XLogP | 6.06 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.46 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|