C24H24BrNO4S2 — CID 19198173
ethyl 2-[(5E)-5-[(5-bromo-2-butoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate (PubChem CID 19198173) has the molecular formula C24H24BrNO4S2 and a molecular weight of 534.50 g/mol. Its IUPAC name is ethyl 2-[(5E)-5-[(5-bromo-2-butoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate.
| Compound Name | ethyl 2-[(5E)-5-[(5-bromo-2-butoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 19198173 |
| Molecular Formula | C24H24BrNO4S2 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 533.03 |
| IUPAC Name | ethyl 2-[(5E)-5-[(5-bromo-2-butoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
| SMILES | CCCCOc1ccc(Br)cc1/C=C1/SC(=S)N(C(C(=O)OCC)c2ccccc2)C1=O |
| InChI | InChI=1S/C24H24BrNO4S2/c1-3-5-13-30-19-12-11-18(25)14-17(19)15-20-22(27)26(24(31)32-20)21(23(28)29-4-2)16-9-7-6-8-10-16/h6-12,14-15,21H,3-5,13H2,1-2H3/b20-15+ |
| InChIKey | FWWPCVAJYPRSMI-HMMYKYKNSA-N |
| XLogP | 6.13 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|