C28H24BrNO4S2 — CID 19198389
propyl 2-[(5Z)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate (PubChem CID 19198389) has the molecular formula C28H24BrNO4S2 and a molecular weight of 582.54 g/mol. Its IUPAC name is propyl 2-[(5Z)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate.
| Compound Name | propyl 2-[(5Z)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 19198389 |
| Molecular Formula | C28H24BrNO4S2 |
| Molecular Weight | 582.54 g/mol |
| Exact Mass | 581.03 |
| IUPAC Name | propyl 2-[(5Z)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
| SMILES | CCCOC(=O)C(c1ccccc1)N1C(=O)/C(=C/c2cc(Br)ccc2OCc2ccccc2)SC1=S |
| InChI | InChI=1S/C28H24BrNO4S2/c1-2-15-33-27(32)25(20-11-7-4-8-12-20)30-26(31)24(36-28(30)35)17-21-16-22(29)13-14-23(21)34-18-19-9-5-3-6-10-19/h3-14,16-17,25H,2,15,18H2,1H3/b24-17- |
| InChIKey | NYLUZEIUZLFLQP-ULJHMMPZSA-N |
| XLogP | 6.92 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.54 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|