C32H33NO4S2 — CID 19198387
propyl 2-[(5E)-5-[[2-[(4-tert-butylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate (PubChem CID 19198387) has the molecular formula C32H33NO4S2 and a molecular weight of 559.75 g/mol. Its IUPAC name is propyl 2-[(5E)-5-[[2-[(4-tert-butylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate.
| Compound Name | propyl 2-[(5E)-5-[[2-[(4-tert-butylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
|---|---|
| PubChem CID | 19198387 |
| Molecular Formula | C32H33NO4S2 |
| Molecular Weight | 559.75 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | propyl 2-[(5E)-5-[[2-[(4-tert-butylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetate |
| SMILES | CCCOC(=O)C(c1ccccc1)N1C(=O)/C(=C\c2ccccc2OCc2ccc(C(C)(C)C)cc2)SC1=S |
| InChI | InChI=1S/C32H33NO4S2/c1-5-19-36-30(35)28(23-11-7-6-8-12-23)33-29(34)27(39-31(33)38)20-24-13-9-10-14-26(24)37-21-22-15-17-25(18-16-22)32(2,3)4/h6-18,20,28H,5,19,21H2,1-4H3/b27-20+ |
| InChIKey | MYYDTVWVAVNIDJ-NHFJDJAPSA-N |
| XLogP | 7.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.75 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|