C24H25NO4S2 — CID 19199483
propyl 4-[(5Z)-4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19199483) has the molecular formula C24H25NO4S2 and a molecular weight of 455.60 g/mol. Its IUPAC name is propyl 4-[(5Z)-4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | propyl 4-[(5Z)-4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19199483 |
| Molecular Formula | C24H25NO4S2 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | propyl 4-[(5Z)-4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CCCOC(=O)CCCN1C(=O)/C(=C/c2ccccc2OCc2ccccc2)SC1=S |
| InChI | InChI=1S/C24H25NO4S2/c1-2-15-28-22(26)13-8-14-25-23(27)21(31-24(25)30)16-19-11-6-7-12-20(19)29-17-18-9-4-3-5-10-18/h3-7,9-12,16H,2,8,13-15,17H2,1H3/b21-16- |
| InChIKey | KXXCYJMDHGYBNS-PGMHBOJBSA-N |
| XLogP | 5.20 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|