C28H33NO4S2 — CID 19199639
propyl 4-[(5E)-5-[[2-[(4-tert-butylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate (PubChem CID 19199639) has the molecular formula C28H33NO4S2 and a molecular weight of 511.71 g/mol. Its IUPAC name is propyl 4-[(5E)-5-[[2-[(4-tert-butylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate.
| Compound Name | propyl 4-[(5E)-5-[[2-[(4-tert-butylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 19199639 |
| Molecular Formula | C28H33NO4S2 |
| Molecular Weight | 511.71 g/mol |
| Exact Mass | 511.19 |
| IUPAC Name | propyl 4-[(5E)-5-[[2-[(4-tert-butylphenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]butanoate |
| SMILES | CCCOC(=O)CCCN1C(=O)/C(=C\c2ccccc2OCc2ccc(C(C)(C)C)cc2)SC1=S |
| InChI | InChI=1S/C28H33NO4S2/c1-5-17-32-25(30)11-8-16-29-26(31)24(35-27(29)34)18-21-9-6-7-10-23(21)33-19-20-12-14-22(15-13-20)28(2,3)4/h6-7,9-10,12-15,18H,5,8,11,16-17,19H2,1-4H3/b24-18+ |
| InChIKey | OSFIAPWAHFHZHX-HKOYGPOVSA-N |
| XLogP | 6.50 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.71 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|