C22H21NO4S2 — CID 3503265
propyl 2-[4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate (PubChem CID 3503265) has the molecular formula C22H21NO4S2 and a molecular weight of 427.55 g/mol. Its IUPAC name is propyl 2-[4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate.
| Compound Name | propyl 2-[4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
|---|---|
| PubChem CID | 3503265 |
| Molecular Formula | C22H21NO4S2 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | propyl 2-[4-oxo-5-[(2-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]acetate |
| SMILES | CCCOC(=O)CN1C(=O)C(=Cc2ccccc2OCc2ccccc2)SC1=S |
| InChI | InChI=1S/C22H21NO4S2/c1-2-12-26-20(24)14-23-21(25)19(29-22(23)28)13-17-10-6-7-11-18(17)27-15-16-8-4-3-5-9-16/h3-11,13H,2,12,14-15H2,1H3 |
| InChIKey | JDQFZSCRJVAJJP-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|