C22H19NO6S2 — CID 43861170
2-[(5Z)-5-[[2-(1-carboxyethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid (PubChem CID 43861170) has the molecular formula C22H19NO6S2 and a molecular weight of 457.53 g/mol. Its IUPAC name is 2-[(5Z)-5-[[2-(1-carboxyethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid.
| Compound Name | 2-[(5Z)-5-[[2-(1-carboxyethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 43861170 |
| Molecular Formula | C22H19NO6S2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | 2-[(5Z)-5-[[2-(1-carboxyethoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
| SMILES | CC(Oc1ccccc1/C=C1\SC(=S)N(C(Cc2ccccc2)C(=O)O)C1=O)C(=O)O |
| InChI | InChI=1S/C22H19NO6S2/c1-13(20(25)26)29-17-10-6-5-9-15(17)12-18-19(24)23(22(30)31-18)16(21(27)28)11-14-7-3-2-4-8-14/h2-10,12-13,16H,11H2,1H3,(H,25,26)(H,27,28)/b18-12- |
| InChIKey | DJFYIMHVZQHGDD-PDGQHHTCSA-N |
| XLogP | 3.44 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|