C26H19Cl2NO4S2 — CID 70691245
(2S)-2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid (PubChem CID 70691245) has the molecular formula C26H19Cl2NO4S2 and a molecular weight of 544.48 g/mol. Its IUPAC name is (2S)-2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 70691245 |
| Molecular Formula | C26H19Cl2NO4S2 |
| Molecular Weight | 544.48 g/mol |
| Exact Mass | 543.01 |
| IUPAC Name | (2S)-2-[(5E)-5-[[4-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](Cc1ccccc1)N1C(=O)/C(=C\c2ccc(OCc3ccc(Cl)cc3Cl)cc2)SC1=S |
| InChI | InChI=1S/C26H19Cl2NO4S2/c27-19-9-8-18(21(28)14-19)15-33-20-10-6-17(7-11-20)13-23-24(30)29(26(34)35-23)22(25(31)32)12-16-4-2-1-3-5-16/h1-11,13-14,22H,12,15H2,(H,31,32)/b23-13+/t22-/m0/s1 |
| InChIKey | FRTUVERYGHWRMU-XMHVBLFMSA-N |
| XLogP | 6.47 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.48 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|