C25H17Cl2NO4S2 — CID 19197732
2-[(5E)-5-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid (PubChem CID 19197732) has the molecular formula C25H17Cl2NO4S2 and a molecular weight of 530.45 g/mol. Its IUPAC name is 2-[(5E)-5-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid.
| Compound Name | 2-[(5E)-5-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid |
|---|---|
| PubChem CID | 19197732 |
| Molecular Formula | C25H17Cl2NO4S2 |
| Molecular Weight | 530.45 g/mol |
| Exact Mass | 529.00 |
| IUPAC Name | 2-[(5E)-5-[[3-[(2,4-dichlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2-phenylacetic acid |
| SMILES | O=C(O)C(c1ccccc1)N1C(=O)/C(=C\c2cccc(OCc3ccc(Cl)cc3Cl)c2)SC1=S |
| InChI | InChI=1S/C25H17Cl2NO4S2/c26-18-10-9-17(20(27)13-18)14-32-19-8-4-5-15(11-19)12-21-23(29)28(25(33)34-21)22(24(30)31)16-6-2-1-3-7-16/h1-13,22H,14H2,(H,30,31)/b21-12+ |
| InChIKey | LVZSJENUNKVGOV-CIAFOILYSA-N |
| XLogP | 6.60 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.45 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|