C26H20Cl2N2O3S2 — CID 126266743
N-(2,4-dichlorophenyl)-2-[3-[(Z)-[4-oxo-3-[(1S)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126266743) has the molecular formula C26H20Cl2N2O3S2 and a molecular weight of 543.50 g/mol. Its IUPAC name is N-(2,4-dichlorophenyl)-2-[3-[(Z)-[4-oxo-3-[(1S)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(2,4-dichlorophenyl)-2-[3-[(Z)-[4-oxo-3-[(1S)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126266743 |
| Molecular Formula | C26H20Cl2N2O3S2 |
| Molecular Weight | 543.50 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | N-(2,4-dichlorophenyl)-2-[3-[(Z)-[4-oxo-3-[(1S)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | C[C@@H](c1ccccc1)N1C(=O)/C(=C/c2cccc(OCC(=O)Nc3ccc(Cl)cc3Cl)c2)SC1=S |
| InChI | InChI=1S/C26H20Cl2N2O3S2/c1-16(18-7-3-2-4-8-18)30-25(32)23(35-26(30)34)13-17-6-5-9-20(12-17)33-15-24(31)29-22-11-10-19(27)14-21(22)28/h2-14,16H,15H2,1H3,(H,29,31)/b23-13-/t16-/m0/s1 |
| InChIKey | SHVFKXACHJQFKO-YOBACFSGSA-N |
| XLogP | 6.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.50 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|