C30H30N2O4S2 — CID 126254385
N-(2,4-dimethylphenyl)-2-[2-ethoxy-4-[(Z)-[4-oxo-3-[(1S)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide (PubChem CID 126254385) has the molecular formula C30H30N2O4S2 and a molecular weight of 546.71 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-2-[2-ethoxy-4-[(Z)-[4-oxo-3-[(1S)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide.
| Compound Name | N-(2,4-dimethylphenyl)-2-[2-ethoxy-4-[(Z)-[4-oxo-3-[(1S)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 126254385 |
| Molecular Formula | C30H30N2O4S2 |
| Molecular Weight | 546.71 g/mol |
| Exact Mass | 546.16 |
| IUPAC Name | N-(2,4-dimethylphenyl)-2-[2-ethoxy-4-[(Z)-[4-oxo-3-[(1S)-1-phenylethyl]-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetamide |
| SMILES | CCOc1cc(/C=C2\SC(=S)N([C@@H](C)c3ccccc3)C2=O)ccc1OCC(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C30H30N2O4S2/c1-5-35-26-16-22(12-14-25(26)36-18-28(33)31-24-13-11-19(2)15-20(24)3)17-27-29(34)32(30(37)38-27)21(4)23-9-7-6-8-10-23/h6-17,21H,5,18H2,1-4H3,(H,31,33)/b27-17-/t21-/m0/s1 |
| InChIKey | CKOZLFZHBQIRSR-RIRGPFDCSA-N |
| XLogP | 6.68 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.71 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|