C24H26N2O4S2 — CID 126350736
2-[2-ethoxy-4-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide (PubChem CID 126350736) has the molecular formula C24H26N2O4S2 and a molecular weight of 470.62 g/mol. Its IUPAC name is 2-[2-ethoxy-4-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide.
| Compound Name | 2-[2-ethoxy-4-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126350736 |
| Molecular Formula | C24H26N2O4S2 |
| Molecular Weight | 470.62 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | 2-[2-ethoxy-4-[(E)-(4-oxo-3-propyl-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]phenoxy]-N-(2-methylphenyl)acetamide |
| SMILES | CCCN1C(=O)/C(=C\c2ccc(OCC(=O)Nc3ccccc3C)c(OCC)c2)SC1=S |
| InChI | InChI=1S/C24H26N2O4S2/c1-4-12-26-23(28)21(32-24(26)31)14-17-10-11-19(20(13-17)29-5-2)30-15-22(27)25-18-9-7-6-8-16(18)3/h6-11,13-14H,4-5,12,15H2,1-3H3,(H,25,27)/b21-14+ |
| InChIKey | GYTSZZJNZCLFQJ-KGENOOAVSA-N |
| XLogP | 5.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.62 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|