C23H21ClN2O6S2 — CID 126261166
3-[(5Z)-5-[[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 126261166) has the molecular formula C23H21ClN2O6S2 and a molecular weight of 521.02 g/mol. Its IUPAC name is 3-[(5Z)-5-[[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-5-[[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 126261166 |
| Molecular Formula | C23H21ClN2O6S2 |
| Molecular Weight | 521.02 g/mol |
| Exact Mass | 520.05 |
| IUPAC Name | 3-[(5Z)-5-[[4-[2-(2-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(CCC(=O)O)C2=O)ccc1OCC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C23H21ClN2O6S2/c1-2-31-18-11-14(12-19-22(30)26(23(33)34-19)10-9-21(28)29)7-8-17(18)32-13-20(27)25-16-6-4-3-5-15(16)24/h3-8,11-12H,2,9-10,13H2,1H3,(H,25,27)(H,28,29)/b19-12- |
| InChIKey | GONBPATXZOWUAE-UNOMPAQXSA-N |
| XLogP | 4.43 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.02 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|