C22H18Cl2N2O6S2 — CID 126272169
3-[(5Z)-5-[[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid (PubChem CID 126272169) has the molecular formula C22H18Cl2N2O6S2 and a molecular weight of 541.43 g/mol. Its IUPAC name is 3-[(5Z)-5-[[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid.
| Compound Name | 3-[(5Z)-5-[[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 126272169 |
| Molecular Formula | C22H18Cl2N2O6S2 |
| Molecular Weight | 541.43 g/mol |
| Exact Mass | 540.00 |
| IUPAC Name | 3-[(5Z)-5-[[4-[2-(3,5-dichloroanilino)-2-oxoethoxy]-3-methoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoic acid |
| SMILES | COc1cc(/C=C2\SC(=S)N(CCC(=O)O)C2=O)ccc1OCC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C22H18Cl2N2O6S2/c1-31-17-6-12(7-18-21(30)26(22(33)34-18)5-4-20(28)29)2-3-16(17)32-11-19(27)25-15-9-13(23)8-14(24)10-15/h2-3,6-10H,4-5,11H2,1H3,(H,25,27)(H,28,29)/b18-7- |
| InChIKey | XJYMQXUUFAXLPI-WSVATBPTSA-N |
| XLogP | 4.70 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|