C28H24ClN3O5S2 — CID 126344388
4-chloro-N-[(5Z)-5-[[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126344388) has the molecular formula C28H24ClN3O5S2 and a molecular weight of 582.10 g/mol. Its IUPAC name is 4-chloro-N-[(5Z)-5-[[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(5Z)-5-[[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126344388 |
| Molecular Formula | C28H24ClN3O5S2 |
| Molecular Weight | 582.10 g/mol |
| Exact Mass | 581.08 |
| IUPAC Name | 4-chloro-N-[(5Z)-5-[[3-ethoxy-4-[2-(2-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(NC(=O)c3ccc(Cl)cc3)C2=O)ccc1OCC(=O)Nc1ccccc1C |
| InChI | InChI=1S/C28H24ClN3O5S2/c1-3-36-23-14-18(8-13-22(23)37-16-25(33)30-21-7-5-4-6-17(21)2)15-24-27(35)32(28(38)39-24)31-26(34)19-9-11-20(29)12-10-19/h4-15H,3,16H2,1-2H3,(H,30,33)(H,31,34)/b24-15- |
| InChIKey | GPZXHVNPBNTYOA-IWIPYMOSSA-N |
| XLogP | 5.61 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.10 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|