C28H23Cl2N3O5S2 — CID 126155975
2-chloro-N-[(5E)-5-[[4-[2-(3-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide (PubChem CID 126155975) has the molecular formula C28H23Cl2N3O5S2 and a molecular weight of 616.55 g/mol. Its IUPAC name is 2-chloro-N-[(5E)-5-[[4-[2-(3-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(5E)-5-[[4-[2-(3-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 126155975 |
| Molecular Formula | C28H23Cl2N3O5S2 |
| Molecular Weight | 616.55 g/mol |
| Exact Mass | 615.05 |
| IUPAC Name | 2-chloro-N-[(5E)-5-[[4-[2-(3-chloroanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(NC(=O)c3ccc(C)cc3Cl)C2=O)ccc1OCC(=O)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C28H23Cl2N3O5S2/c1-3-37-23-12-17(8-10-22(23)38-15-25(34)31-19-6-4-5-18(29)14-19)13-24-27(36)33(28(39)40-24)32-26(35)20-9-7-16(2)11-21(20)30/h4-14H,3,15H2,1-2H3,(H,31,34)(H,32,35)/b24-13+ |
| InChIKey | NOFKYGISCVMVID-ZMOGYAJESA-N |
| XLogP | 6.26 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.55 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|