C26H23N3O5S3 — CID 126351381
N-[(5Z)-5-[[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide (PubChem CID 126351381) has the molecular formula C26H23N3O5S3 and a molecular weight of 553.69 g/mol. Its IUPAC name is N-[(5Z)-5-[[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[(5Z)-5-[[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126351381 |
| Molecular Formula | C26H23N3O5S3 |
| Molecular Weight | 553.69 g/mol |
| Exact Mass | 553.08 |
| IUPAC Name | N-[(5Z)-5-[[3-ethoxy-4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(NC(=O)c3cccs3)C2=O)ccc1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C26H23N3O5S3/c1-3-33-20-13-17(8-11-19(20)34-15-23(30)27-18-9-6-16(2)7-10-18)14-22-25(32)29(26(35)37-22)28-24(31)21-5-4-12-36-21/h4-14H,3,15H2,1-2H3,(H,27,30)(H,28,31)/b22-14- |
| InChIKey | IIKBVSLIRHYNHR-HMAPJEAMSA-N |
| XLogP | 5.02 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.69 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|