C30H28ClN3O5S2 — CID 126151417
2-chloro-N-[(5E)-5-[[4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide (PubChem CID 126151417) has the molecular formula C30H28ClN3O5S2 and a molecular weight of 610.16 g/mol. Its IUPAC name is 2-chloro-N-[(5E)-5-[[4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(5E)-5-[[4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 126151417 |
| Molecular Formula | C30H28ClN3O5S2 |
| Molecular Weight | 610.16 g/mol |
| Exact Mass | 609.12 |
| IUPAC Name | 2-chloro-N-[(5E)-5-[[4-[2-(3,4-dimethylanilino)-2-oxoethoxy]-3-ethoxyphenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(NC(=O)c3ccc(C)cc3Cl)C2=O)ccc1OCC(=O)Nc1ccc(C)c(C)c1 |
| InChI | InChI=1S/C30H28ClN3O5S2/c1-5-38-25-14-20(8-11-24(25)39-16-27(35)32-21-9-7-18(3)19(4)13-21)15-26-29(37)34(30(40)41-26)33-28(36)22-10-6-17(2)12-23(22)31/h6-15H,5,16H2,1-4H3,(H,32,35)(H,33,36)/b26-15+ |
| InChIKey | MSGVLWWBVUNHBJ-CVKSISIWSA-N |
| XLogP | 6.23 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.16 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|