C27H22ClN3O4S2 — CID 126150692
2-chloro-4-methyl-N-[(5E)-5-[[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126150692) has the molecular formula C27H22ClN3O4S2 and a molecular weight of 552.08 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[(5E)-5-[[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 2-chloro-4-methyl-N-[(5E)-5-[[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126150692 |
| Molecular Formula | C27H22ClN3O4S2 |
| Molecular Weight | 552.08 g/mol |
| Exact Mass | 551.07 |
| IUPAC Name | 2-chloro-4-methyl-N-[(5E)-5-[[4-[2-(4-methylanilino)-2-oxoethoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | Cc1ccc(NC(=O)COc2ccc(/C=C3/SC(=S)N(NC(=O)c4ccc(C)cc4Cl)C3=O)cc2)cc1 |
| InChI | InChI=1S/C27H22ClN3O4S2/c1-16-3-8-19(9-4-16)29-24(32)15-35-20-10-6-18(7-11-20)14-23-26(34)31(27(36)37-23)30-25(33)21-12-5-17(2)13-22(21)28/h3-14H,15H2,1-2H3,(H,29,32)(H,30,33)/b23-14+ |
| InChIKey | YGCLRVAGDILHIH-OEAKJJBVSA-N |
| XLogP | 5.52 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.08 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|