C22H17Cl3N2O5S2 — CID 126151431
ethyl 2-[2,6-dichloro-4-[(Z)-[3-[(2-chloro-4-methylbenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126151431) has the molecular formula C22H17Cl3N2O5S2 and a molecular weight of 559.88 g/mol. Its IUPAC name is ethyl 2-[2,6-dichloro-4-[(Z)-[3-[(2-chloro-4-methylbenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2,6-dichloro-4-[(Z)-[3-[(2-chloro-4-methylbenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126151431 |
| Molecular Formula | C22H17Cl3N2O5S2 |
| Molecular Weight | 559.88 g/mol |
| Exact Mass | 557.96 |
| IUPAC Name | ethyl 2-[2,6-dichloro-4-[(Z)-[3-[(2-chloro-4-methylbenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C2\SC(=S)N(NC(=O)c3ccc(C)cc3Cl)C2=O)cc1Cl |
| InChI | InChI=1S/C22H17Cl3N2O5S2/c1-3-31-18(28)10-32-19-15(24)7-12(8-16(19)25)9-17-21(30)27(22(33)34-17)26-20(29)13-5-4-11(2)6-14(13)23/h4-9H,3,10H2,1-2H3,(H,26,29)/b17-9- |
| InChIKey | MWTCHRFIKNXZRV-MFOYZWKCSA-N |
| XLogP | 5.44 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.88 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|