C20H17ClN2O6S3 — CID 4084568
ethyl 2-[2-chloro-6-methoxy-4-[[4-oxo-2-sulfanylidene-3-(thiophene-2-carbonylamino)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 4084568) has the molecular formula C20H17ClN2O6S3 and a molecular weight of 513.02 g/mol. Its IUPAC name is ethyl 2-[2-chloro-6-methoxy-4-[[4-oxo-2-sulfanylidene-3-(thiophene-2-carbonylamino)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-6-methoxy-4-[[4-oxo-2-sulfanylidene-3-(thiophene-2-carbonylamino)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 4084568 |
| Molecular Formula | C20H17ClN2O6S3 |
| Molecular Weight | 513.02 g/mol |
| Exact Mass | 511.99 |
| IUPAC Name | ethyl 2-[2-chloro-6-methoxy-4-[[4-oxo-2-sulfanylidene-3-(thiophene-2-carbonylamino)-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(C=C2SC(=S)N(NC(=O)c3cccs3)C2=O)cc1OC |
| InChI | InChI=1S/C20H17ClN2O6S3/c1-3-28-16(24)10-29-17-12(21)7-11(8-13(17)27-2)9-15-19(26)23(20(30)32-15)22-18(25)14-5-4-6-31-14/h4-9H,3,10H2,1-2H3,(H,22,25) |
| InChIKey | RVAZMIXTADPZIO-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.02 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|