C21H16Cl3NO5S2 — CID 126334678
ethyl 2-[2-chloro-4-[(E)-[3-(3,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate (PubChem CID 126334678) has the molecular formula C21H16Cl3NO5S2 and a molecular weight of 532.85 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-[(E)-[3-(3,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate.
| Compound Name | ethyl 2-[2-chloro-4-[(E)-[3-(3,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126334678 |
| Molecular Formula | C21H16Cl3NO5S2 |
| Molecular Weight | 532.85 g/mol |
| Exact Mass | 530.95 |
| IUPAC Name | ethyl 2-[2-chloro-4-[(E)-[3-(3,4-dichlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-6-methoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(/C=C2/SC(=S)N(c3ccc(Cl)c(Cl)c3)C2=O)cc1OC |
| InChI | InChI=1S/C21H16Cl3NO5S2/c1-3-29-18(26)10-30-19-15(24)6-11(7-16(19)28-2)8-17-20(27)25(21(31)32-17)12-4-5-13(22)14(23)9-12/h4-9H,3,10H2,1-2H3/b17-8+ |
| InChIKey | XDPOWYXSJRBTMU-CAOOACKPSA-N |
| XLogP | 6.00 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.85 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|