C20H15ClINO5S2 — CID 126354537
methyl 2-[4-[(E)-[3-(4-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 126354537) has the molecular formula C20H15ClINO5S2 and a molecular weight of 575.83 g/mol. Its IUPAC name is methyl 2-[4-[(E)-[3-(4-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-[3-(4-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126354537 |
| Molecular Formula | C20H15ClINO5S2 |
| Molecular Weight | 575.83 g/mol |
| Exact Mass | 574.91 |
| IUPAC Name | methyl 2-[4-[(E)-[3-(4-chlorophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(/C=C2/SC(=S)N(c3ccc(Cl)cc3)C2=O)cc1OC |
| InChI | InChI=1S/C20H15ClINO5S2/c1-26-15-8-11(7-14(22)18(15)28-10-17(24)27-2)9-16-19(25)23(20(29)30-16)13-5-3-12(21)4-6-13/h3-9H,10H2,1-2H3/b16-9+ |
| InChIKey | OSFSZQJLLMVUKV-CXUHLZMHSA-N |
| XLogP | 4.91 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.83 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|