C23H22INO5S2 — CID 126354850
methyl 2-[4-[(Z)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 126354850) has the molecular formula C23H22INO5S2 and a molecular weight of 583.47 g/mol. Its IUPAC name is methyl 2-[4-[(Z)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | methyl 2-[4-[(Z)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126354850 |
| Molecular Formula | C23H22INO5S2 |
| Molecular Weight | 583.47 g/mol |
| Exact Mass | 583.00 |
| IUPAC Name | methyl 2-[4-[(Z)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOc1cc(/C=C2\SC(=S)N(c3ccc(C)cc3C)C2=O)cc(I)c1OCC(=O)OC |
| InChI | InChI=1S/C23H22INO5S2/c1-5-29-18-10-15(9-16(24)21(18)30-12-20(26)28-4)11-19-22(27)25(23(31)32-19)17-7-6-13(2)8-14(17)3/h6-11H,5,12H2,1-4H3/b19-11- |
| InChIKey | UQCNUEOTWSLPCE-ODLFYWEKSA-N |
| XLogP | 5.26 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.47 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|