C22H19IN2O6S2 — CID 126183959
methyl 2-[4-[(E)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetate (PubChem CID 126183959) has the molecular formula C22H19IN2O6S2 and a molecular weight of 598.44 g/mol. Its IUPAC name is methyl 2-[4-[(E)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetate |
|---|---|
| PubChem CID | 126183959 |
| Molecular Formula | C22H19IN2O6S2 |
| Molecular Weight | 598.44 g/mol |
| Exact Mass | 597.97 |
| IUPAC Name | methyl 2-[4-[(E)-(3-benzamido-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene)methyl]-2-ethoxy-6-iodophenoxy]acetate |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(NC(=O)c3ccccc3)C2=O)cc(I)c1OCC(=O)OC |
| InChI | InChI=1S/C22H19IN2O6S2/c1-3-30-16-10-13(9-15(23)19(16)31-12-18(26)29-2)11-17-21(28)25(22(32)33-17)24-20(27)14-7-5-4-6-8-14/h4-11H,3,12H2,1-2H3,(H,24,27)/b17-11+ |
| InChIKey | GGRIXJBMDQMRGY-GZTJUZNOSA-N |
| XLogP | 3.79 |
| TPSA | 94.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.44 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|