C19H17IN2O4S3 — CID 126338983
N-[(5E)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide (PubChem CID 126338983) has the molecular formula C19H17IN2O4S3 and a molecular weight of 560.46 g/mol. Its IUPAC name is N-[(5E)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[(5E)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126338983 |
| Molecular Formula | C19H17IN2O4S3 |
| Molecular Weight | 560.46 g/mol |
| Exact Mass | 559.94 |
| IUPAC Name | N-[(5E)-5-[(3,4-diethoxy-5-iodophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(NC(=O)c3cccs3)C2=O)cc(I)c1OCC |
| InChI | InChI=1S/C19H17IN2O4S3/c1-3-25-13-9-11(8-12(20)16(13)26-4-2)10-15-18(24)22(19(27)29-15)21-17(23)14-6-5-7-28-14/h5-10H,3-4H2,1-2H3,(H,21,23)/b15-10+ |
| InChIKey | RQGQEGVYSRBSGC-XNTDXEJSSA-N |
| XLogP | 4.70 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|