C27H24N2O4S3 — CID 126345173
N-[(5Z)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide (PubChem CID 126345173) has the molecular formula C27H24N2O4S3 and a molecular weight of 536.70 g/mol. Its IUPAC name is N-[(5Z)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[(5Z)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126345173 |
| Molecular Formula | C27H24N2O4S3 |
| Molecular Weight | 536.70 g/mol |
| Exact Mass | 536.09 |
| IUPAC Name | N-[(5Z)-5-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
| SMILES | C=CCc1cc(/C=C2\SC(=S)N(NC(=O)c3cccs3)C2=O)cc(OCC)c1OCc1ccccc1 |
| InChI | InChI=1S/C27H24N2O4S3/c1-3-9-20-14-19(15-21(32-4-2)24(20)33-17-18-10-6-5-7-11-18)16-23-26(31)29(27(34)36-23)28-25(30)22-12-8-13-35-22/h3,5-8,10-16H,1,4,9,17H2,2H3,(H,28,30)/b23-16- |
| InChIKey | DOCHDJBDGUBWJK-KQWNVCNZSA-N |
| XLogP | 6.00 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.70 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|