C22H15BrN2O3S3 — CID 126344583
N-[(5Z)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide (PubChem CID 126344583) has the molecular formula C22H15BrN2O3S3 and a molecular weight of 531.48 g/mol. Its IUPAC name is N-[(5Z)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[(5Z)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126344583 |
| Molecular Formula | C22H15BrN2O3S3 |
| Molecular Weight | 531.48 g/mol |
| Exact Mass | 529.94 |
| IUPAC Name | N-[(5Z)-5-[(5-bromo-2-phenylmethoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(NN1C(=O)/C(=C/c2cc(Br)ccc2OCc2ccccc2)SC1=S)c1cccs1 |
| InChI | InChI=1S/C22H15BrN2O3S3/c23-16-8-9-17(28-13-14-5-2-1-3-6-14)15(11-16)12-19-21(27)25(22(29)31-19)24-20(26)18-7-4-10-30-18/h1-12H,13H2,(H,24,26)/b19-12- |
| InChIKey | KELSDJNFEADBMZ-UNOMPAQXSA-N |
| XLogP | 5.64 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|