C22H13Br2ClN2O3S3 — CID 126356863
N-[(5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide (PubChem CID 126356863) has the molecular formula C22H13Br2ClN2O3S3 and a molecular weight of 644.82 g/mol. Its IUPAC name is N-[(5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[(5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126356863 |
| Molecular Formula | C22H13Br2ClN2O3S3 |
| Molecular Weight | 644.82 g/mol |
| Exact Mass | 641.81 |
| IUPAC Name | N-[(5E)-5-[[3,5-dibromo-4-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(NN1C(=O)/C(=C\c2cc(Br)c(OCc3ccccc3Cl)c(Br)c2)SC1=S)c1cccs1 |
| InChI | InChI=1S/C22H13Br2ClN2O3S3/c23-14-8-12(9-15(24)19(14)30-11-13-4-1-2-5-16(13)25)10-18-21(29)27(22(31)33-18)26-20(28)17-6-3-7-32-17/h1-10H,11H2,(H,26,28)/b18-10+ |
| InChIKey | ZQUISPVXIKNVBB-VCHYOVAHSA-N |
| XLogP | 7.05 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.82 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|