C24H16Cl2N2O3S2 — CID 19200269
2-chloro-N-[(5E)-5-[[3-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 19200269) has the molecular formula C24H16Cl2N2O3S2 and a molecular weight of 515.44 g/mol. Its IUPAC name is 2-chloro-N-[(5E)-5-[[3-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 2-chloro-N-[(5E)-5-[[3-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 19200269 |
| Molecular Formula | C24H16Cl2N2O3S2 |
| Molecular Weight | 515.44 g/mol |
| Exact Mass | 514.00 |
| IUPAC Name | 2-chloro-N-[(5E)-5-[[3-[(2-chlorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(NN1C(=O)/C(=C\c2cccc(OCc3ccccc3Cl)c2)SC1=S)c1ccccc1Cl |
| InChI | InChI=1S/C24H16Cl2N2O3S2/c25-19-10-3-1-7-16(19)14-31-17-8-5-6-15(12-17)13-21-23(30)28(24(32)33-21)27-22(29)18-9-2-4-11-20(18)26/h1-13H,14H2,(H,27,29)/b21-13+ |
| InChIKey | ZLASQRPQLQQRGC-FYJGNVAPSA-N |
| XLogP | 6.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.44 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|