C24H16ClFN2O3S2 — CID 126345961
4-chloro-N-[(5E)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126345961) has the molecular formula C24H16ClFN2O3S2 and a molecular weight of 498.99 g/mol. Its IUPAC name is 4-chloro-N-[(5E)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 4-chloro-N-[(5E)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126345961 |
| Molecular Formula | C24H16ClFN2O3S2 |
| Molecular Weight | 498.99 g/mol |
| Exact Mass | 498.03 |
| IUPAC Name | 4-chloro-N-[(5E)-5-[[3-[(2-fluorophenyl)methoxy]phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(NN1C(=O)/C(=C\c2cccc(OCc3ccccc3F)c2)SC1=S)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C24H16ClFN2O3S2/c25-18-10-8-16(9-11-18)22(29)27-28-23(30)21(33-24(28)32)13-15-4-3-6-19(12-15)31-14-17-5-1-2-7-20(17)26/h1-13H,14H2,(H,27,29)/b21-13+ |
| InChIKey | ZEQDQPYVFZEXAD-FYJGNVAPSA-N |
| XLogP | 5.60 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.99 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|