C26H19ClN2O6S2 — CID 43862518
2-[3-[(E)-[3-[[4-[(2-chlorophenyl)methoxy]benzoyl]amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid (PubChem CID 43862518) has the molecular formula C26H19ClN2O6S2 and a molecular weight of 555.03 g/mol. Its IUPAC name is 2-[3-[(E)-[3-[[4-[(2-chlorophenyl)methoxy]benzoyl]amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid.
| Compound Name | 2-[3-[(E)-[3-[[4-[(2-chlorophenyl)methoxy]benzoyl]amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 43862518 |
| Molecular Formula | C26H19ClN2O6S2 |
| Molecular Weight | 555.03 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | 2-[3-[(E)-[3-[[4-[(2-chlorophenyl)methoxy]benzoyl]amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetic acid |
| SMILES | O=C(O)COc1cccc(/C=C2/SC(=S)N(NC(=O)c3ccc(OCc4ccccc4Cl)cc3)C2=O)c1 |
| InChI | InChI=1S/C26H19ClN2O6S2/c27-21-7-2-1-5-18(21)14-34-19-10-8-17(9-11-19)24(32)28-29-25(33)22(37-26(29)36)13-16-4-3-6-20(12-16)35-15-23(30)31/h1-13H,14-15H2,(H,28,32)(H,30,31)/b22-13+ |
| InChIKey | SETKVAYDDIRFMZ-LPYMAVHISA-N |
| XLogP | 4.93 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.03 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|