C22H16N2O3S3 — CID 126335278
N-[(5E)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide (PubChem CID 126335278) has the molecular formula C22H16N2O3S3 and a molecular weight of 452.58 g/mol. Its IUPAC name is N-[(5E)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[(5E)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126335278 |
| Molecular Formula | C22H16N2O3S3 |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.03 |
| IUPAC Name | N-[(5E)-4-oxo-5-[(3-phenylmethoxyphenyl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
| SMILES | O=C(NN1C(=O)/C(=C\c2cccc(OCc3ccccc3)c2)SC1=S)c1cccs1 |
| InChI | InChI=1S/C22H16N2O3S3/c25-20(18-10-5-11-29-18)23-24-21(26)19(30-22(24)28)13-16-8-4-9-17(12-16)27-14-15-6-2-1-3-7-15/h1-13H,14H2,(H,23,25)/b19-13+ |
| InChIKey | CXPNLUSSRHZVCT-CPNJWEJPSA-N |
| XLogP | 4.87 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|