C16H11BrN2O4S3 — CID 126347348
N-[(5Z)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide (PubChem CID 126347348) has the molecular formula C16H11BrN2O4S3 and a molecular weight of 471.38 g/mol. Its IUPAC name is N-[(5Z)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide.
| Compound Name | N-[(5Z)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 126347348 |
| Molecular Formula | C16H11BrN2O4S3 |
| Molecular Weight | 471.38 g/mol |
| Exact Mass | 469.91 |
| IUPAC Name | N-[(5Z)-5-[(2-bromo-4-hydroxy-5-methoxyphenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]thiophene-2-carboxamide |
| SMILES | COc1cc(/C=C2\SC(=S)N(NC(=O)c3cccs3)C2=O)c(Br)cc1O |
| InChI | InChI=1S/C16H11BrN2O4S3/c1-23-11-5-8(9(17)7-10(11)20)6-13-15(22)19(16(24)26-13)18-14(21)12-3-2-4-25-12/h2-7,20H,1H3,(H,18,21)/b13-6- |
| InChIKey | AOSOIMFLJYIXJO-MLPAPPSSSA-N |
| XLogP | 3.77 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.38 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|