C22H20INO5S2 — CID 126348309
methyl 2-[4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate (PubChem CID 126348309) has the molecular formula C22H20INO5S2 and a molecular weight of 569.44 g/mol. Its IUPAC name is methyl 2-[4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate.
| Compound Name | methyl 2-[4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126348309 |
| Molecular Formula | C22H20INO5S2 |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 568.98 |
| IUPAC Name | methyl 2-[4-[(E)-[3-(2,4-dimethylphenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2-iodo-6-methoxyphenoxy]acetate |
| SMILES | COC(=O)COc1c(I)cc(/C=C2/SC(=S)N(c3ccc(C)cc3C)C2=O)cc1OC |
| InChI | InChI=1S/C22H20INO5S2/c1-12-5-6-16(13(2)7-12)24-21(26)18(31-22(24)30)10-14-8-15(23)20(17(9-14)27-3)29-11-19(25)28-4/h5-10H,11H2,1-4H3/b18-10+ |
| InChIKey | CZUNHNQVSDNKME-VCHYOVAHSA-N |
| XLogP | 4.87 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|