C21H17ClN2O7S2 — CID 126349889
methyl 2-[2-chloro-6-ethoxy-4-[(E)-[3-(4-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate (PubChem CID 126349889) has the molecular formula C21H17ClN2O7S2 and a molecular weight of 508.96 g/mol. Its IUPAC name is methyl 2-[2-chloro-6-ethoxy-4-[(E)-[3-(4-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[2-chloro-6-ethoxy-4-[(E)-[3-(4-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 126349889 |
| Molecular Formula | C21H17ClN2O7S2 |
| Molecular Weight | 508.96 g/mol |
| Exact Mass | 508.02 |
| IUPAC Name | methyl 2-[2-chloro-6-ethoxy-4-[(E)-[3-(4-nitrophenyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]acetate |
| SMILES | CCOc1cc(/C=C2/SC(=S)N(c3ccc([N+](=O)[O-])cc3)C2=O)cc(Cl)c1OCC(=O)OC |
| InChI | InChI=1S/C21H17ClN2O7S2/c1-3-30-16-9-12(8-15(22)19(16)31-11-18(25)29-2)10-17-20(26)23(21(32)33-17)13-4-6-14(7-5-13)24(27)28/h4-10H,3,11H2,1-2H3/b17-10+ |
| InChIKey | DSJRVSMEVHOQLT-LICLKQGHSA-N |
| XLogP | 4.60 |
| TPSA | 108.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.96 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|