C18H11Cl3N2O2S2 — CID 126151621
2-chloro-N-[(5E)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide (PubChem CID 126151621) has the molecular formula C18H11Cl3N2O2S2 and a molecular weight of 457.79 g/mol. Its IUPAC name is 2-chloro-N-[(5E)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(5E)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 126151621 |
| Molecular Formula | C18H11Cl3N2O2S2 |
| Molecular Weight | 457.79 g/mol |
| Exact Mass | 455.93 |
| IUPAC Name | 2-chloro-N-[(5E)-5-[(2,6-dichlorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NN2C(=O)/C(=C\c3c(Cl)cccc3Cl)SC2=S)c(Cl)c1 |
| InChI | InChI=1S/C18H11Cl3N2O2S2/c1-9-5-6-10(14(21)7-9)16(24)22-23-17(25)15(27-18(23)26)8-11-12(19)3-2-4-13(11)20/h2-8H,1H3,(H,22,24)/b15-8+ |
| InChIKey | OKZSVXGNYJSYMY-OVCLIPMQSA-N |
| XLogP | 5.50 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.79 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|