C17H10Cl2N2O2S2 — CID 6201025
N-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2,4-dichlorobenzamide (PubChem CID 6201025) has the molecular formula C17H10Cl2N2O2S2 and a molecular weight of 409.32 g/mol. Its IUPAC name is N-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2,4-dichlorobenzamide.
| Compound Name | N-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2,4-dichlorobenzamide |
|---|---|
| PubChem CID | 6201025 |
| Molecular Formula | C17H10Cl2N2O2S2 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 407.96 |
| IUPAC Name | N-[(5Z)-5-benzylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-2,4-dichlorobenzamide |
| SMILES | O=C(NN1C(=O)/C(=C/c2ccccc2)SC1=S)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H10Cl2N2O2S2/c18-11-6-7-12(13(19)9-11)15(22)20-21-16(23)14(25-17(21)24)8-10-4-2-1-3-5-10/h1-9H,(H,20,22)/b14-8- |
| InChIKey | OTUGNSRGZFGOPE-ZSOIEALJSA-N |
| XLogP | 4.54 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|