C20H14Cl2N2O5S2 — CID 27418037
3-[2-[(E)-[3-[(2,4-dichlorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid (PubChem CID 27418037) has the molecular formula C20H14Cl2N2O5S2 and a molecular weight of 497.38 g/mol. Its IUPAC name is 3-[2-[(E)-[3-[(2,4-dichlorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid.
| Compound Name | 3-[2-[(E)-[3-[(2,4-dichlorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 27418037 |
| Molecular Formula | C20H14Cl2N2O5S2 |
| Molecular Weight | 497.38 g/mol |
| Exact Mass | 495.97 |
| IUPAC Name | 3-[2-[(E)-[3-[(2,4-dichlorobenzoyl)amino]-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]phenoxy]propanoic acid |
| SMILES | O=C(O)CCOc1ccccc1/C=C1/SC(=S)N(NC(=O)c2ccc(Cl)cc2Cl)C1=O |
| InChI | InChI=1S/C20H14Cl2N2O5S2/c21-12-5-6-13(14(22)10-12)18(27)23-24-19(28)16(31-20(24)30)9-11-3-1-2-4-15(11)29-8-7-17(25)26/h1-6,9-10H,7-8H2,(H,23,27)(H,25,26)/b16-9+ |
| InChIKey | ATOVRNAZAUEHIZ-CXUHLZMHSA-N |
| XLogP | 4.39 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.38 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|