C15H9Cl2N3O2S2 — CID 6207175
2,4-dichloro-N-[(5Z)-4-oxo-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 6207175) has the molecular formula C15H9Cl2N3O2S2 and a molecular weight of 398.30 g/mol. Its IUPAC name is 2,4-dichloro-N-[(5Z)-4-oxo-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 2,4-dichloro-N-[(5Z)-4-oxo-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 6207175 |
| Molecular Formula | C15H9Cl2N3O2S2 |
| Molecular Weight | 398.30 g/mol |
| Exact Mass | 396.95 |
| IUPAC Name | 2,4-dichloro-N-[(5Z)-4-oxo-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | O=C(NN1C(=O)/C(=C/c2ccc[nH]2)SC1=S)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C15H9Cl2N3O2S2/c16-8-3-4-10(11(17)6-8)13(21)19-20-14(22)12(24-15(20)23)7-9-2-1-5-18-9/h1-7,18H,(H,19,21)/b12-7- |
| InChIKey | ITHZSQCQYUHPPI-GHXNOFRVSA-N |
| XLogP | 3.87 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.30 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|