C16H12ClN3O2S2 — CID 126336791
2-chloro-4-methyl-N-[(5E)-4-oxo-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126336791) has the molecular formula C16H12ClN3O2S2 and a molecular weight of 377.88 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[(5E)-4-oxo-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 2-chloro-4-methyl-N-[(5E)-4-oxo-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126336791 |
| Molecular Formula | C16H12ClN3O2S2 |
| Molecular Weight | 377.88 g/mol |
| Exact Mass | 377.01 |
| IUPAC Name | 2-chloro-4-methyl-N-[(5E)-4-oxo-5-(1H-pyrrol-2-ylmethylidene)-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | Cc1ccc(C(=O)NN2C(=O)/C(=C\c3ccc[nH]3)SC2=S)c(Cl)c1 |
| InChI | InChI=1S/C16H12ClN3O2S2/c1-9-4-5-11(12(17)7-9)14(21)19-20-15(22)13(24-16(20)23)8-10-3-2-6-18-10/h2-8,18H,1H3,(H,19,21)/b13-8+ |
| InChIKey | LIPKMOPHAPWKTB-MDWZMJQESA-N |
| XLogP | 3.52 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.88 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|