C12H9ClN2O2S2 — CID 134377006
2-chloro-4-methyl-N-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzamide (PubChem CID 134377006) has the molecular formula C12H9ClN2O2S2 and a molecular weight of 312.80 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzamide.
| Compound Name | 2-chloro-4-methyl-N-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 134377006 |
| Molecular Formula | C12H9ClN2O2S2 |
| Molecular Weight | 312.80 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | 2-chloro-4-methyl-N-(5-methylidene-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl)benzamide |
| SMILES | C=C1SC(=S)N(NC(=O)c2ccc(C)cc2Cl)C1=O |
| InChI | InChI=1S/C12H9ClN2O2S2/c1-6-3-4-8(9(13)5-6)10(16)14-15-11(17)7(2)19-12(15)18/h3-5H,2H2,1H3,(H,14,16) |
| InChIKey | JCZXGYDMDVYILQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.80 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|