C21H13ClN2O4S2 — CID 126380290
2-chloro-4-methyl-N-[(5Z)-4-oxo-5-[(4-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 126380290) has the molecular formula C21H13ClN2O4S2 and a molecular weight of 456.93 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[(5Z)-4-oxo-5-[(4-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 2-chloro-4-methyl-N-[(5Z)-4-oxo-5-[(4-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 126380290 |
| Molecular Formula | C21H13ClN2O4S2 |
| Molecular Weight | 456.93 g/mol |
| Exact Mass | 456.00 |
| IUPAC Name | 2-chloro-4-methyl-N-[(5Z)-4-oxo-5-[(4-oxochromen-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | Cc1ccc(C(=O)NN2C(=O)/C(=C/c3coc4ccccc4c3=O)SC2=S)c(Cl)c1 |
| InChI | InChI=1S/C21H13ClN2O4S2/c1-11-6-7-13(15(22)8-11)19(26)23-24-20(27)17(30-21(24)29)9-12-10-28-16-5-3-2-4-14(16)18(12)25/h2-10H,1H3,(H,23,26)/b17-9- |
| InChIKey | OCGLDZWPFYNRII-MFOYZWKCSA-N |
| XLogP | 4.30 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|