C24H15ClN4O7S2 — CID 126150726
2-chloro-N-[(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide (PubChem CID 126150726) has the molecular formula C24H15ClN4O7S2 and a molecular weight of 570.99 g/mol. Its IUPAC name is 2-chloro-N-[(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide.
| Compound Name | 2-chloro-N-[(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide |
|---|---|
| PubChem CID | 126150726 |
| Molecular Formula | C24H15ClN4O7S2 |
| Molecular Weight | 570.99 g/mol |
| Exact Mass | 570.01 |
| IUPAC Name | 2-chloro-N-[(5E)-5-[[2-(2,4-dinitrophenoxy)phenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NN2C(=O)/C(=C\c3ccccc3Oc3ccc([N+](=O)[O-])cc3[N+](=O)[O-])SC2=S)c(Cl)c1 |
| InChI | InChI=1S/C24H15ClN4O7S2/c1-13-6-8-16(17(25)10-13)22(30)26-27-23(31)21(38-24(27)37)11-14-4-2-3-5-19(14)36-20-9-7-15(28(32)33)12-18(20)29(34)35/h2-12H,1H3,(H,26,30)/b21-11+ |
| InChIKey | YMUCDEDHDRUGFP-SRZZPIQSSA-N |
| XLogP | 5.80 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.99 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|