C25H18ClN3O4S3 — CID 6078754
2-chloro-4-methyl-N-[(5Z)-5-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide (PubChem CID 6078754) has the molecular formula C25H18ClN3O4S3 and a molecular weight of 556.09 g/mol. Its IUPAC name is 2-chloro-4-methyl-N-[(5Z)-5-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide.
| Compound Name | 2-chloro-4-methyl-N-[(5Z)-5-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
|---|---|
| PubChem CID | 6078754 |
| Molecular Formula | C25H18ClN3O4S3 |
| Molecular Weight | 556.09 g/mol |
| Exact Mass | 555.01 |
| IUPAC Name | 2-chloro-4-methyl-N-[(5Z)-5-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]benzamide |
| SMILES | Cc1ccc(Sc2ccc(/C=C3\SC(=S)N(NC(=O)c4ccc(C)cc4Cl)C3=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H18ClN3O4S3/c1-14-3-7-17(8-4-14)35-21-10-6-16(12-20(21)29(32)33)13-22-24(31)28(25(34)36-22)27-23(30)18-9-5-15(2)11-19(18)26/h3-13H,1-2H3,(H,27,30)/b22-13- |
| InChIKey | BWRUJAUJVSWWSY-XKZIYDEJSA-N |
| XLogP | 6.56 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.09 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|