C24H18N2O3S3 — CID 6007340
(5E)-3-(4-methylphenyl)-5-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 6007340) has the molecular formula C24H18N2O3S3 and a molecular weight of 478.62 g/mol. Its IUPAC name is (5E)-3-(4-methylphenyl)-5-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(4-methylphenyl)-5-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 6007340 |
| Molecular Formula | C24H18N2O3S3 |
| Molecular Weight | 478.62 g/mol |
| Exact Mass | 478.05 |
| IUPAC Name | (5E)-3-(4-methylphenyl)-5-[[4-(4-methylphenyl)sulfanyl-3-nitrophenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | Cc1ccc(Sc2ccc(/C=C3/SC(=S)N(c4ccc(C)cc4)C3=O)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H18N2O3S3/c1-15-3-8-18(9-4-15)25-23(27)22(32-24(25)30)14-17-7-12-21(20(13-17)26(28)29)31-19-10-5-16(2)6-11-19/h3-14H,1-2H3/b22-14+ |
| InChIKey | NTWYCOBZZUGTLN-HYARGMPZSA-N |
| XLogP | 6.77 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.62 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|